methyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate

C14H22O3 — CID 67089209

IUPACmethyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate
SMILESCOC(=O)C=CC1=C(C)C(OC)CCC1(C)C
InChIInChI=1S/C14H22O3/c1-10-11(6-7-13(15)17-5)14(2,3)9-8-12(10)16-4/h6-7,12H,8-9H2,1-5H3
InChIKeyDGOMCYWLTUGORY-UHFFFAOYSA-N
MW238.33 g/mol
LogP2.87
Rot. Bonds3

About methyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate

methyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate (PubChem CID 67089209) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is methyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate.

Molecular Properties

Compound Namemethyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate
PubChem CID67089209
Molecular FormulaC14H22O3
Molecular Weight238.33 g/mol
Exact Mass238.16
IUPAC Namemethyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate
SMILESCOC(=O)C=CC1=C(C)C(OC)CCC1(C)C
InChIInChI=1S/C14H22O3/c1-10-11(6-7-13(15)17-5)14(2,3)9-8-12(10)16-4/h6-7,12H,8-9H2,1-5H3
InChIKeyDGOMCYWLTUGORY-UHFFFAOYSA-N
XLogP2.87
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.33
LogP ≤ 52.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate?
The IUPAC name of methyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate (CID 67089209) is methyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate.
What is the SMILES notation for methyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate?
The canonical SMILES for methyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate is COC(=O)C=CC1=C(C)C(OC)CCC1(C)C.
What is the InChIKey of methyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate?
The InChIKey is DGOMCYWLTUGORY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3/c1-10-11(6-7-13(15)17-5)14(2,3)9-8-12(10)16-4/h6-7,12H,8-9H2,1-5H3.
What are the key properties of methyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate?
methyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate has a molecular weight of 238.33 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoate is sourced from PubChem (CID 67089209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).