C41H56O — CID 11180552
1-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,6,6-trimethylcyclohexa-1,3-diene (PubChem CID 11180552) has the molecular formula C41H56O and a molecular weight of 564.90 g/mol. Its IUPAC name is 1-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,6,6-trimethylcyclohexa-1,3-diene.
| Compound Name | 1-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,6,6-trimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 11180552 |
| Molecular Formula | C41H56O |
| Molecular Weight | 564.90 g/mol |
| Exact Mass | 564.43 |
| IUPAC Name | 1-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(3-methoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,6,6-trimethylcyclohexa-1,3-diene |
| SMILES | COC1CCC(C)(C)C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)C=CCC2(C)C)=C1C |
| InChI | InChI=1S/C41H56O/c1-31(19-14-21-33(3)24-26-37-35(5)23-16-29-40(37,7)8)17-12-13-18-32(2)20-15-22-34(4)25-27-38-36(6)39(42-11)28-30-41(38,9)10/h12-27,39H,28-30H2,1-11H3/b13-12+,19-14+,20-15+,26-24+,27-25+,31-17+,32-18+,33-21+,34-22+ |
| InChIKey | PJTYTRHGPCPXPA-PDAMJFCGSA-N |
| XLogP | 12.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.90 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|