C20H27NO3 — CID 59256258
[3-[(1E,3E,5E,7Z)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-yl] nitrite (PubChem CID 59256258) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is [3-[(1E,3E,5E,7Z)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-yl] nitrite.
| Compound Name | [3-[(1E,3E,5E,7Z)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-yl] nitrite |
|---|---|
| PubChem CID | 59256258 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | [3-[(1E,3E,5E,7Z)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-yl] nitrite |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C\C=O)C(C)(C)CCC1ON=O |
| InChI | InChI=1S/C20H27NO3/c1-15(7-6-8-16(2)12-14-22)9-10-18-17(3)19(24-21-23)11-13-20(18,4)5/h6-10,12,14,19H,11,13H2,1-5H3/b8-6+,10-9+,15-7+,16-12- |
| InChIKey | VWDMEMXJVZAQSI-FFIIYDNGSA-N |
| XLogP | 5.39 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|