C21H36O2Si — CID 11810208
(2E,4E)-5-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpenta-2,4-dienal (PubChem CID 11810208) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is (2E,4E)-5-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpenta-2,4-dienal.
| Compound Name | (2E,4E)-5-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpenta-2,4-dienal |
|---|---|
| PubChem CID | 11810208 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (2E,4E)-5-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpenta-2,4-dienal |
| SMILES | CC1=C(/C=C/C(C)=C/C=O)C(C)(C)CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O2Si/c1-16(13-15-22)10-11-18-17(2)19(12-14-21(18,6)7)23-24(8,9)20(3,4)5/h10-11,13,15,19H,12,14H2,1-9H3/b11-10+,16-13+/t19-/m1/s1 |
| InChIKey | GWCHSUWHZNFVND-CDZZBCEKSA-N |
| XLogP | 6.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|