C17H30O2Si — CID 11022793
3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-methylidenecyclohexene-1-carbaldehyde (PubChem CID 11022793) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-methylidenecyclohexene-1-carbaldehyde.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-methylidenecyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 11022793 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-methylidenecyclohexene-1-carbaldehyde |
| SMILES | C=C1CC(O[Si](C)(C)C(C)(C)C)C(C)=C(C=O)C1(C)C |
| InChI | InChI=1S/C17H30O2Si/c1-12-10-15(19-20(8,9)16(3,4)5)13(2)14(11-18)17(12,6)7/h11,15H,1,10H2,2-9H3 |
| InChIKey | JATVZAQESMXPGB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|