C33H48O4 — CID 88560845
[3-[(1E,3E,5E,7E)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-yl] (E)-12-oxotridec-2-enoate (PubChem CID 88560845) has the molecular formula C33H48O4 and a molecular weight of 508.74 g/mol. Its IUPAC name is [3-[(1E,3E,5E,7E)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-yl] (E)-12-oxotridec-2-enoate.
| Compound Name | [3-[(1E,3E,5E,7E)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-yl] (E)-12-oxotridec-2-enoate |
|---|---|
| PubChem CID | 88560845 |
| Molecular Formula | C33H48O4 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | [3-[(1E,3E,5E,7E)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-yl] (E)-12-oxotridec-2-enoate |
| SMILES | CC(=O)CCCCCCCC/C=C/C(=O)OC1CCC(C)(C)C(/C=C/C(C)=C/C=C/C(C)=C/C=O)=C1C |
| InChI | InChI=1S/C33H48O4/c1-26(16-15-17-27(2)23-25-34)20-21-30-29(4)31(22-24-33(30,5)6)37-32(36)19-14-12-10-8-7-9-11-13-18-28(3)35/h14-17,19-21,23,25,31H,7-13,18,22,24H2,1-6H3/b17-15+,19-14+,21-20+,26-16+,27-23+ |
| InChIKey | VIKXWUXHDMVBPJ-UNVLHBCJSA-N |
| XLogP | 8.50 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|