C28H40O3S2 — CID 91393011
[3-(3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl)-2,4,4-trimethylcyclohex-2-en-1-yl] 5-(dithiolan-3-yl)pentanoate (PubChem CID 91393011) has the molecular formula C28H40O3S2 and a molecular weight of 488.76 g/mol. Its IUPAC name is [3-(3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl)-2,4,4-trimethylcyclohex-2-en-1-yl] 5-(dithiolan-3-yl)pentanoate.
| Compound Name | [3-(3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl)-2,4,4-trimethylcyclohex-2-en-1-yl] 5-(dithiolan-3-yl)pentanoate |
|---|---|
| PubChem CID | 91393011 |
| Molecular Formula | C28H40O3S2 |
| Molecular Weight | 488.76 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [3-(3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl)-2,4,4-trimethylcyclohex-2-en-1-yl] 5-(dithiolan-3-yl)pentanoate |
| SMILES | CC(C=CC=C(C)C=CC1=C(C)C(OC(=O)CCCCC2CCSS2)CCC1(C)C)=CC=O |
| InChI | InChI=1S/C28H40O3S2/c1-21(9-8-10-22(2)16-19-29)13-14-25-23(3)26(15-18-28(25,4)5)31-27(30)12-7-6-11-24-17-20-32-33-24/h8-10,13-14,16,19,24,26H,6-7,11-12,15,17-18,20H2,1-5H3 |
| InChIKey | SEJCKAPVVGUQFE-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.76 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|