C32H46O5 — CID 59392553
[3-[(1E,3E,5E,7E)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-yl] (E)-10-acetyloxydec-2-enoate (PubChem CID 59392553) has the molecular formula C32H46O5 and a molecular weight of 510.72 g/mol. Its IUPAC name is [3-[(1E,3E,5E,7E)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-yl] (E)-10-acetyloxydec-2-enoate.
| Compound Name | [3-[(1E,3E,5E,7E)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-yl] (E)-10-acetyloxydec-2-enoate |
|---|---|
| PubChem CID | 59392553 |
| Molecular Formula | C32H46O5 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | [3-[(1E,3E,5E,7E)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-yl] (E)-10-acetyloxydec-2-enoate |
| SMILES | CC(=O)OCCCCCCC/C=C/C(=O)OC1CCC(C)(C)C(/C=C/C(C)=C/C=C/C(C)=C/C=O)=C1C |
| InChI | InChI=1S/C32H46O5/c1-25(15-14-16-26(2)21-23-33)18-19-29-27(3)30(20-22-32(29,5)6)37-31(35)17-12-10-8-7-9-11-13-24-36-28(4)34/h12,14-19,21,23,30H,7-11,13,20,22,24H2,1-6H3/b16-14+,17-12+,19-18+,25-15+,26-21+ |
| InChIKey | AUXPKBDZZOGTOQ-DGCFGCRSSA-N |
| XLogP | 7.70 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|