C24H35NO2 — CID 11210893
2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]ethyl acetate (PubChem CID 11210893) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]ethyl acetate.
| Compound Name | 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]ethyl acetate |
|---|---|
| PubChem CID | 11210893 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]ethyl acetate |
| SMILES | CC(=O)OCC/N=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C24H35NO2/c1-19(12-13-23-21(3)11-8-15-24(23,5)6)9-7-10-20(2)14-16-25-17-18-27-22(4)26/h7,9-10,12-14,16H,8,11,15,17-18H2,1-6H3/b10-7+,13-12+,19-9+,20-14+,25-16+ |
| InChIKey | YJGZKQDKWUMCFF-NWHWWKONSA-N |
| XLogP | 6.15 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|