C21H35NOSi — CID 10860902
(2E,4E)-3-methyl-5-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)penta-2,4-dienenitrile (PubChem CID 10860902) has the molecular formula C21H35NOSi and a molecular weight of 345.60 g/mol. Its IUPAC name is (2E,4E)-3-methyl-5-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)penta-2,4-dienenitrile.
| Compound Name | (2E,4E)-3-methyl-5-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 10860902 |
| Molecular Formula | C21H35NOSi |
| Molecular Weight | 345.60 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | (2E,4E)-3-methyl-5-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)penta-2,4-dienenitrile |
| SMILES | CC[Si](CC)(CC)OC1CCC(C)(C)C(/C=C/C(C)=C/C#N)=C1C |
| InChI | InChI=1S/C21H35NOSi/c1-8-24(9-2,10-3)23-20-13-15-21(6,7)19(18(20)5)12-11-17(4)14-16-22/h11-12,14,20H,8-10,13,15H2,1-7H3/b12-11+,17-14+ |
| InChIKey | QNYKIHWAOPMOQF-MUIYJVFTSA-N |
| XLogP | 6.54 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.60 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|