C21H29N — CID 10709150
(2E,4E,6E,8E)-3,7-dimethyl-6-(113C)methyl-9-(2,6,6-trimethylcyclohexen-1-yl)(313C)nona-2,4,6,8-tetraenenitrile (PubChem CID 10709150) has the molecular formula C21H29N and a molecular weight of 297.45 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,7-dimethyl-6-(113C)methyl-9-(2,6,6-trimethylcyclohexen-1-yl)(313C)nona-2,4,6,8-tetraenenitrile.
| Compound Name | (2E,4E,6E,8E)-3,7-dimethyl-6-(113C)methyl-9-(2,6,6-trimethylcyclohexen-1-yl)(313C)nona-2,4,6,8-tetraenenitrile |
|---|---|
| PubChem CID | 10709150 |
| Molecular Formula | C21H29N |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-6-(113C)methyl-9-(2,6,6-trimethylcyclohexen-1-yl)(313C)nona-2,4,6,8-tetraenenitrile |
| SMILES | CC1=C(/C=C/C(C)=C([13CH3])/C=C/[13C](C)=C/C#N)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H29N/c1-16(13-15-22)9-10-17(2)18(3)11-12-20-19(4)8-7-14-21(20,5)6/h9-13H,7-8,14H2,1-6H3/b10-9+,12-11+,16-13+,18-17+/i2+1,16+1 |
| InChIKey | PKDVGPMFUMVVHX-FRPUEDGGSA-N |
| XLogP | 6.43 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|