C15H21N — CID 57369176
5-[3,3-dideuterio-6,6-dimethyl-2-(trideuteriomethyl)cyclohexen-1-yl]-3-methylpenta-2,4-dienenitrile (PubChem CID 57369176) has the molecular formula C15H21N and a molecular weight of 220.37 g/mol. Its IUPAC name is 5-[3,3-dideuterio-6,6-dimethyl-2-(trideuteriomethyl)cyclohexen-1-yl]-3-methylpenta-2,4-dienenitrile.
| Compound Name | 5-[3,3-dideuterio-6,6-dimethyl-2-(trideuteriomethyl)cyclohexen-1-yl]-3-methylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 57369176 |
| Molecular Formula | C15H21N |
| Molecular Weight | 220.37 g/mol |
| Exact Mass | 220.20 |
| IUPAC Name | 5-[3,3-dideuterio-6,6-dimethyl-2-(trideuteriomethyl)cyclohexen-1-yl]-3-methylpenta-2,4-dienenitrile |
| SMILES | [2H]C([2H])([2H])C1=C(C=CC(C)=CC#N)C(C)(C)CCC1([2H])[2H] |
| InChI | InChI=1S/C15H21N/c1-12(9-11-16)7-8-14-13(2)6-5-10-15(14,3)4/h7-9H,5-6,10H2,1-4H3/i2D3,6D2 |
| InChIKey | YOYODHNOTKUUDY-QKLSXCJMSA-N |
| XLogP | 4.54 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|