C28H32N2 — CID 10692151
(2E,4Z,6E,8E)-7-(1H-indol-3-ylmethyl)-3-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenenitrile (PubChem CID 10692151) has the molecular formula C28H32N2 and a molecular weight of 396.58 g/mol. Its IUPAC name is (2E,4Z,6E,8E)-7-(1H-indol-3-ylmethyl)-3-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenenitrile.
| Compound Name | (2E,4Z,6E,8E)-7-(1H-indol-3-ylmethyl)-3-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenenitrile |
|---|---|
| PubChem CID | 10692151 |
| Molecular Formula | C28H32N2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | (2E,4Z,6E,8E)-7-(1H-indol-3-ylmethyl)-3-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenenitrile |
| SMILES | CC1=C(/C=C/C(=C/C=C\C(C)=C\C#N)Cc2c[nH]c3ccccc23)C(C)(C)CCC1 |
| InChI | InChI=1S/C28H32N2/c1-21(16-18-29)9-7-11-23(14-15-26-22(2)10-8-17-28(26,3)4)19-24-20-30-27-13-6-5-12-25(24)27/h5-7,9,11-16,20,30H,8,10,17,19H2,1-4H3/b9-7-,15-14+,21-16+,23-11- |
| InChIKey | FXCCXSGEZGJHMB-ZDRZTDCPSA-N |
| XLogP | 7.75 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|