C15H21NO2 — CID 14631319
(2E,4E)-5-[(3R,4S)-3,4-dihydroxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpenta-2,4-dienenitrile (PubChem CID 14631319) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (2E,4E)-5-[(3R,4S)-3,4-dihydroxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpenta-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-[(3R,4S)-3,4-dihydroxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 14631319 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (2E,4E)-5-[(3R,4S)-3,4-dihydroxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpenta-2,4-dienenitrile |
| SMILES | CC1=C(/C=C/C(C)=C/C#N)C(C)(C)C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H21NO2/c1-10(7-8-16)5-6-12-11(2)14(18)13(17)9-15(12,3)4/h5-7,13-14,17-18H,9H2,1-4H3/b6-5+,10-7+/t13-,14+/m0/s1 |
| InChIKey | VDXSIJPDHUVNGD-ILCKGCMTSA-N |
| XLogP | 2.48 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|