C42H60O5 — CID 163043568
[4-[18-(3,4-dihydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3-hydroxy-3,5,5-trimethylcyclohexyl] acetate (PubChem CID 163043568) has the molecular formula C42H60O5 and a molecular weight of 644.94 g/mol. Its IUPAC name is [4-[18-(3,4-dihydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3-hydroxy-3,5,5-trimethylcyclohexyl] acetate.
| Compound Name | [4-[18-(3,4-dihydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3-hydroxy-3,5,5-trimethylcyclohexyl] acetate |
|---|---|
| PubChem CID | 163043568 |
| Molecular Formula | C42H60O5 |
| Molecular Weight | 644.94 g/mol |
| Exact Mass | 644.44 |
| IUPAC Name | [4-[18-(3,4-dihydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3-hydroxy-3,5,5-trimethylcyclohexyl] acetate |
| SMILES | CC(=O)OC1CC(C)(C)C(C=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC2=C(C)C(O)C(O)CC2(C)C)C(C)(O)C1 |
| InChI | InChI=1S/C42H60O5/c1-29(18-14-20-31(3)22-24-36-33(5)39(45)37(44)28-40(36,7)8)16-12-13-17-30(2)19-15-21-32(4)23-25-38-41(9,10)26-35(47-34(6)43)27-42(38,11)46/h12-25,35,37-39,44-46H,26-28H2,1-11H3 |
| InChIKey | VDRHKRFIRSWEMD-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.94 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|