C42H58O2 — CID 73425495
[(1R)-3,5,5-trimethyl-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-3-en-1-yl] acetate (PubChem CID 73425495) has the molecular formula C42H58O2 and a molecular weight of 594.92 g/mol. Its IUPAC name is [(1R)-3,5,5-trimethyl-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R)-3,5,5-trimethyl-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 73425495 |
| Molecular Formula | C42H58O2 |
| Molecular Weight | 594.92 g/mol |
| Exact Mass | 594.44 |
| IUPAC Name | [(1R)-3,5,5-trimethyl-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC(C)=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)CCCC2(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C42H58O2/c1-31(19-14-21-33(3)24-26-39-35(5)23-16-28-41(39,8)9)17-12-13-18-32(2)20-15-22-34(4)25-27-40-36(6)29-38(44-37(7)43)30-42(40,10)11/h12-15,17-22,24-27,38H,16,23,28-30H2,1-11H3/b13-12+,19-14+,20-15+,26-24+,27-25+,31-17+,32-18+,33-21+,34-22+/t38-/m1/s1 |
| InChIKey | FMPGIACYOGJFQX-CPQPWORTSA-N |
| XLogP | 12.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.92 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|