C18H26O — CID 10801408
(3E,5Z,7E)-1,1,1-trideuterio-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-one (PubChem CID 10801408) has the molecular formula C18H26O and a molecular weight of 261.42 g/mol. Its IUPAC name is (3E,5Z,7E)-1,1,1-trideuterio-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-one.
| Compound Name | (3E,5Z,7E)-1,1,1-trideuterio-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 10801408 |
| Molecular Formula | C18H26O |
| Molecular Weight | 261.42 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | (3E,5Z,7E)-1,1,1-trideuterio-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-one |
| SMILES | [2H]C([2H])([2H])C(=O)/C=C/C=C(C)\C=C\C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C18H26O/c1-14(8-6-10-16(3)19)11-12-17-15(2)9-7-13-18(17,4)5/h6,8,10-12H,7,9,13H2,1-5H3/b10-6+,12-11+,14-8-/i3D3 |
| InChIKey | UBTNVRPIHJRBCI-KKXUSMCSSA-N |
| XLogP | 5.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|