C22H28O — CID 102131023
(2E,4E,6E,8E,10E)-3,7-dimethyl-11-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)undeca-2,4,6,8,10-pentaenal (PubChem CID 102131023) has the molecular formula C22H28O and a molecular weight of 308.47 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E)-3,7-dimethyl-11-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)undeca-2,4,6,8,10-pentaenal.
| Compound Name | (2E,4E,6E,8E,10E)-3,7-dimethyl-11-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)undeca-2,4,6,8,10-pentaenal |
|---|---|
| PubChem CID | 102131023 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | (2E,4E,6E,8E,10E)-3,7-dimethyl-11-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)undeca-2,4,6,8,10-pentaenal |
| SMILES | CC1=C(/C=C/C=C/C(C)=C/C=C/C(C)=C/C=O)C(C)(C)CC=C1 |
| InChI | InChI=1S/C22H28O/c1-18(11-8-12-19(2)15-17-23)10-6-7-14-21-20(3)13-9-16-22(21,4)5/h6-15,17H,16H2,1-5H3/b10-6+,12-8+,14-7+,18-11+,19-15+ |
| InChIKey | IRZLGFBDZYTCKU-XGUNWFTRSA-N |
| XLogP | 6.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|