C20H31O4 — CID 58182516
CID 58182516 (PubChem CID 58182516) has the molecular formula C20H31O4 and a molecular weight of 335.46 g/mol.
| Compound Name | CID 58182516 |
|---|---|
| PubChem CID | 58182516 |
| Molecular Formula | C20H31O4 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | — |
| SMILES | CC(=O)O[CH]C(C)C(=O)O[C@@H]1CCC(C)(C)C(/C=C/C(C)C)=C1C |
| InChI | InChI=1S/C20H31O4/c1-13(2)8-9-17-15(4)18(10-11-20(17,6)7)24-19(22)14(3)12-23-16(5)21/h8-9,12-14,18H,10-11H2,1-7H3/b9-8+/t14?,18-/m1/s1 |
| InChIKey | ISUNXYUSRQJBPY-VOVBJCLESA-N |
| XLogP | 4.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |