About [(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate
[(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate (PubChem CID 11053499) has the molecular formula C15H20O2
and a molecular weight of 232.32 g/mol. Its IUPAC name is [(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate.
Molecular Properties
| Compound Name | [(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate |
| PubChem CID | 11053499 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | [(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate |
| SMILES | C=CC1=C(C)[C@@H](OC(=O)C#CC)CCC1(C)C |
| InChI | InChI=1S/C15H20O2/c1-6-8-14(16)17-13-9-10-15(4,5)12(7-2)11(13)3/h7,13H,2,9-10H2,1,3-5H3/t13-/m0/s1 |
| InChIKey | NCGZWBWOCFUPCN-ZDUSSCGKSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate?
The IUPAC name of [(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate (CID 11053499) is [(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate.
What is the SMILES notation for [(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate?
The canonical SMILES for [(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate is C=CC1=C(C)[C@@H](OC(=O)C#CC)CCC1(C)C.
What is the InChIKey of [(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate?
The InChIKey is NCGZWBWOCFUPCN-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H20O2/c1-6-8-14(16)17-13-9-10-15(4,5)12(7-2)11(13)3/h7,13H,2,9-10H2,1,3-5H3/t13-/m0/s1.
What are the key properties of [(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate?
[(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate has a molecular weight of 232.32 g/mol, XLogP of 3.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-3-ethenyl-2,4,4-trimethylcyclohex-2-en-1-yl] but-2-ynoate is sourced from PubChem (CID 11053499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).