C23H31N3O2 — CID 101065205
methyl (2E,4E,6E,8E)-3,7-dimethyl-9-[(3S)-2,6,6-trimethyl-3-(1,2,4-triazol-4-yl)cyclohexen-1-yl]nona-2,4,6,8-tetraenoate (PubChem CID 101065205) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is methyl (2E,4E,6E,8E)-3,7-dimethyl-9-[(3S)-2,6,6-trimethyl-3-(1,2,4-triazol-4-yl)cyclohexen-1-yl]nona-2,4,6,8-tetraenoate.
| Compound Name | methyl (2E,4E,6E,8E)-3,7-dimethyl-9-[(3S)-2,6,6-trimethyl-3-(1,2,4-triazol-4-yl)cyclohexen-1-yl]nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 101065205 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | methyl (2E,4E,6E,8E)-3,7-dimethyl-9-[(3S)-2,6,6-trimethyl-3-(1,2,4-triazol-4-yl)cyclohexen-1-yl]nona-2,4,6,8-tetraenoate |
| SMILES | COC(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)[C@@H](n2cnnc2)CCC1(C)C |
| InChI | InChI=1S/C23H31N3O2/c1-17(8-7-9-18(2)14-22(27)28-6)10-11-20-19(3)21(12-13-23(20,4)5)26-15-24-25-16-26/h7-11,14-16,21H,12-13H2,1-6H3/b9-7+,11-10+,17-8+,18-14+/t21-/m0/s1 |
| InChIKey | ITEPPBMYBFWUJN-IVAMQIJXSA-N |
| XLogP | 5.13 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|