C22H31N3O2 — CID 91491909
9-[3-(1,3-dihydro-1,2,4-triazol-2-yl)-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid (PubChem CID 91491909) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 9-[3-(1,3-dihydro-1,2,4-triazol-2-yl)-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid.
| Compound Name | 9-[3-(1,3-dihydro-1,2,4-triazol-2-yl)-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 91491909 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 9-[3-(1,3-dihydro-1,2,4-triazol-2-yl)-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| SMILES | CC(C=CC1=C(C)C(N2CN=CN2)CCC1(C)C)=CC=CC(C)=CC(=O)O |
| InChI | InChI=1S/C22H31N3O2/c1-16(7-6-8-17(2)13-21(26)27)9-10-19-18(3)20(11-12-22(19,4)5)25-15-23-14-24-25/h6-10,13-14,20H,11-12,15H2,1-5H3,(H,23,24)(H,26,27) |
| InChIKey | VUFJIZRZXIAJPP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|