C29H33F2N3O — CID 75095987
N-(2,6-difluorophenyl)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide (PubChem CID 75095987) has the molecular formula C29H33F2N3O and a molecular weight of 477.60 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide.
| Compound Name | N-(2,6-difluorophenyl)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 75095987 |
| Molecular Formula | C29H33F2N3O |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | N-(2,6-difluorophenyl)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide |
| SMILES | CC(C=CC1=C(C)C(n2ccnc2)CCC1(C)C)=CC=CC(C)=CC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C29H33F2N3O/c1-20(8-6-9-21(2)18-27(35)33-28-24(30)10-7-11-25(28)31)12-13-23-22(3)26(14-15-29(23,4)5)34-17-16-32-19-34/h6-13,16-19,26H,14-15H2,1-5H3,(H,33,35) |
| InChIKey | HNGUUBDYGIAWLB-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|