C29H35N7OS — CID 45138733
(2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-(1-methyl-6-sulfanylidenepurin-9-yl)nona-2,4,6,8-tetraenamide (PubChem CID 45138733) has the molecular formula C29H35N7OS and a molecular weight of 529.71 g/mol. Its IUPAC name is (2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-(1-methyl-6-sulfanylidenepurin-9-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-(1-methyl-6-sulfanylidenepurin-9-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 45138733 |
| Molecular Formula | C29H35N7OS |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | (2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-(1-methyl-6-sulfanylidenepurin-9-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nn2cnc3c(=S)n(C)cnc32)C(C)(C)CCC1n1ccnc1 |
| InChI | InChI=1S/C29H35N7OS/c1-20(10-11-23-22(3)24(12-13-29(23,4)5)35-15-14-30-17-35)8-7-9-21(2)16-25(37)33-36-19-31-26-27(36)32-18-34(6)28(26)38/h7-11,14-19,24H,12-13H2,1-6H3,(H,33,37)/b9-7+,11-10+,20-8+,21-16+ |
| InChIKey | HADJIIHEFAVNTL-OWAJRDGUSA-N |
| XLogP | 6.15 |
| TPSA | 82.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|