C26H32N4O — CID 11373414
(2E,4E,6E,8E)-1-imidazol-1-yl-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraen-1-one (PubChem CID 11373414) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is (2E,4E,6E,8E)-1-imidazol-1-yl-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraen-1-one.
| Compound Name | (2E,4E,6E,8E)-1-imidazol-1-yl-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraen-1-one |
|---|---|
| PubChem CID | 11373414 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (2E,4E,6E,8E)-1-imidazol-1-yl-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraen-1-one |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)n2ccnc2)C(C)(C)CCC1n1ccnc1 |
| InChI | InChI=1S/C26H32N4O/c1-20(7-6-8-21(2)17-25(31)30-16-14-28-19-30)9-10-23-22(3)24(11-12-26(23,4)5)29-15-13-27-18-29/h6-10,13-19,24H,11-12H2,1-5H3/b8-6+,10-9+,20-7+,21-17+ |
| InChIKey | YATHTDAMJIBVQL-NOTPUAICSA-N |
| XLogP | 6.10 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|