C30H34N4O — CID 45137366
(2E,4E,6E,8E)-N-(3-cyanophenyl)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide (PubChem CID 45137366) has the molecular formula C30H34N4O and a molecular weight of 466.63 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-(3-cyanophenyl)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N-(3-cyanophenyl)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 45137366 |
| Molecular Formula | C30H34N4O |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | (2E,4E,6E,8E)-N-(3-cyanophenyl)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2cccc(C#N)c2)C(C)(C)CCC1n1ccnc1 |
| InChI | InChI=1S/C30H34N4O/c1-22(8-6-9-23(2)18-29(35)33-26-11-7-10-25(19-26)20-31)12-13-27-24(3)28(14-15-30(27,4)5)34-17-16-32-21-34/h6-13,16-19,21,28H,14-15H2,1-5H3,(H,33,35)/b9-6+,13-12+,22-8+,23-18+ |
| InChIKey | CQOKWIJSUHKPOB-UNNCUKDRSA-N |
| XLogP | 7.08 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|