C31H38IN3O — CID 156797776
(2E,4E,6E,8E)-9-[3-(2-imidazol-1-ylethyl)-2,6,6-trimethylcyclohexen-1-yl]-N-(4-iodophenyl)-3,7-dimethylnona-2,4,6,8-tetraenamide (PubChem CID 156797776) has the molecular formula C31H38IN3O and a molecular weight of 595.57 g/mol. Its IUPAC name is (2E,4E,6E,8E)-9-[3-(2-imidazol-1-ylethyl)-2,6,6-trimethylcyclohexen-1-yl]-N-(4-iodophenyl)-3,7-dimethylnona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-9-[3-(2-imidazol-1-ylethyl)-2,6,6-trimethylcyclohexen-1-yl]-N-(4-iodophenyl)-3,7-dimethylnona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 156797776 |
| Molecular Formula | C31H38IN3O |
| Molecular Weight | 595.57 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | (2E,4E,6E,8E)-9-[3-(2-imidazol-1-ylethyl)-2,6,6-trimethylcyclohexen-1-yl]-N-(4-iodophenyl)-3,7-dimethylnona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2ccc(I)cc2)C(C)(C)CCC1CCn1ccnc1 |
| InChI | InChI=1S/C31H38IN3O/c1-23(7-6-8-24(2)21-30(36)34-28-12-10-27(32)11-13-28)9-14-29-25(3)26(15-17-31(29,4)5)16-19-35-20-18-33-22-35/h6-14,18,20-22,26H,15-17,19H2,1-5H3,(H,34,36)/b8-6+,14-9+,23-7+,24-21+ |
| InChIKey | FBJATAPWQPRVGH-JRIFUUDHSA-N |
| XLogP | 8.27 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.57 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|