C29H35N3OS — CID 45137370
(2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-(3-sulfanylphenyl)nona-2,4,6,8-tetraenamide (PubChem CID 45137370) has the molecular formula C29H35N3OS and a molecular weight of 473.69 g/mol. Its IUPAC name is (2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-(3-sulfanylphenyl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-(3-sulfanylphenyl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 45137370 |
| Molecular Formula | C29H35N3OS |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | (2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-(3-sulfanylphenyl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2cccc(S)c2)C(C)(C)CCC1n1ccnc1 |
| InChI | InChI=1S/C29H35N3OS/c1-21(8-6-9-22(2)18-28(33)31-24-10-7-11-25(34)19-24)12-13-26-23(3)27(14-15-29(26,4)5)32-17-16-30-20-32/h6-13,16-20,27,34H,14-15H2,1-5H3,(H,31,33)/b9-6+,13-12+,21-8+,22-18+ |
| InChIKey | LVWBEECQVTYJSB-NSTXEIOUSA-N |
| XLogP | 7.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|