C30H39N3O — CID 143964052
(2E,4E,6E,8E)-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide (PubChem CID 143964052) has the molecular formula C30H39N3O and a molecular weight of 457.66 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 143964052 |
| Molecular Formula | C30H39N3O |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.31 |
| IUPAC Name | (2E,4E,6E,8E)-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide |
| SMILES | C=C/C(=C\C=C/C)NC(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C(n2ccnc2)CCC1(C)C |
| InChI | InChI=1S/C30H39N3O/c1-8-10-14-26(9-2)32-29(34)21-24(4)13-11-12-23(3)15-16-27-25(5)28(17-18-30(27,6)7)33-20-19-31-22-33/h8-16,19-22,28H,2,17-18H2,1,3-7H3,(H,32,34)/b10-8-,13-11+,16-15+,23-12+,24-21+,26-14+ |
| InChIKey | FXEHUUKOBKQLGI-WHDAKRHRSA-N |
| XLogP | 7.33 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|