C29H34N6OS — CID 45138588
(2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-1-(1-methyl-6-sulfanylidenepurin-9-yl)nona-2,4,6,8-tetraen-1-one (PubChem CID 45138588) has the molecular formula C29H34N6OS and a molecular weight of 514.70 g/mol. Its IUPAC name is (2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-1-(1-methyl-6-sulfanylidenepurin-9-yl)nona-2,4,6,8-tetraen-1-one.
| Compound Name | (2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-1-(1-methyl-6-sulfanylidenepurin-9-yl)nona-2,4,6,8-tetraen-1-one |
|---|---|
| PubChem CID | 45138588 |
| Molecular Formula | C29H34N6OS |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | (2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-1-(1-methyl-6-sulfanylidenepurin-9-yl)nona-2,4,6,8-tetraen-1-one |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)n2cnc3c(=S)n(C)cnc32)C(C)(C)CCC1n1ccnc1 |
| InChI | InChI=1S/C29H34N6OS/c1-20(10-11-23-22(3)24(12-13-29(23,4)5)34-15-14-30-17-34)8-7-9-21(2)16-25(36)35-19-31-26-27(35)32-18-33(6)28(26)37/h7-11,14-19,24H,12-13H2,1-6H3/b9-7+,11-10+,20-8+,21-16+ |
| InChIKey | SORKTYSBWMDBHD-OWAJRDGUSA-N |
| XLogP | 6.72 |
| TPSA | 70.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|