C25H33N7O — CID 75096155
9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-(1-methyltetrazol-5-yl)nona-2,4,6,8-tetraenamide (PubChem CID 75096155) has the molecular formula C25H33N7O and a molecular weight of 447.59 g/mol. Its IUPAC name is 9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-(1-methyltetrazol-5-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | 9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-(1-methyltetrazol-5-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 75096155 |
| Molecular Formula | C25H33N7O |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-(1-methyltetrazol-5-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC(C=CC1=C(C)C(n2ccnc2)CCC1(C)C)=CC=CC(C)=CC(=O)Nc1nnnn1C |
| InChI | InChI=1S/C25H33N7O/c1-18(8-7-9-19(2)16-23(33)27-24-28-29-30-31(24)6)10-11-21-20(3)22(12-13-25(21,4)5)32-15-14-26-17-32/h7-11,14-17,22H,12-13H2,1-6H3,(H,27,28,30,33) |
| InChIKey | DBMQBEHLLNUKIS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|