C31H41N3O — CID 123992239
ethane;(2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-phenylnona-2,4,6,8-tetraenamide (PubChem CID 123992239) has the molecular formula C31H41N3O and a molecular weight of 471.69 g/mol. Its IUPAC name is ethane;(2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-phenylnona-2,4,6,8-tetraenamide.
| Compound Name | ethane;(2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-phenylnona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 123992239 |
| Molecular Formula | C31H41N3O |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | ethane;(2E,4E,6E,8E)-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethyl-N-phenylnona-2,4,6,8-tetraenamide |
| SMILES | CC.CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2ccccc2)C(C)(C)CCC1n1ccnc1 |
| InChI | InChI=1S/C29H35N3O.C2H6/c1-22(10-9-11-23(2)20-28(33)31-25-12-7-6-8-13-25)14-15-26-24(3)27(16-17-29(26,4)5)32-19-18-30-21-32;1-2/h6-15,18-21,27H,16-17H2,1-5H3,(H,31,33);1-2H3/b11-9+,15-14+,22-10+,23-20+; |
| InChIKey | SFKALAWBEZALBA-FNSSIBJASA-N |
| XLogP | 8.23 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|