C30H37F2N3O — CID 143964053
(2E,4E,6E,8E)-N-(3,5-difluorophenyl)-9-[3-(imidazol-1-ylmethyl)-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenamide;molecular hydrogen (PubChem CID 143964053) has the molecular formula C30H37F2N3O and a molecular weight of 493.64 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-(3,5-difluorophenyl)-9-[3-(imidazol-1-ylmethyl)-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenamide;molecular hydrogen.
| Compound Name | (2E,4E,6E,8E)-N-(3,5-difluorophenyl)-9-[3-(imidazol-1-ylmethyl)-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenamide;molecular hydrogen |
|---|---|
| PubChem CID | 143964053 |
| Molecular Formula | C30H37F2N3O |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | (2E,4E,6E,8E)-N-(3,5-difluorophenyl)-9-[3-(imidazol-1-ylmethyl)-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenamide;molecular hydrogen |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2cc(F)cc(F)c2)C(C)(C)CCC1Cn1ccnc1.[H][H] |
| InChI | InChI=1S/C30H35F2N3O.H2/c1-21(7-6-8-22(2)15-29(36)34-27-17-25(31)16-26(32)18-27)9-10-28-23(3)24(11-12-30(28,4)5)19-35-14-13-33-20-35;/h6-10,13-18,20,24H,11-12,19H2,1-5H3,(H,34,36);1H/b8-6+,10-9+,21-7+,22-15+; |
| InChIKey | KQUIJVPJEHDFCL-APTHMBKISA-N |
| XLogP | 7.80 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|