C32H46FN3O2 — CID 169177722
(2E,4E,6E,8E)-N-(4-fluorocyclohexyl)-9-[3-hydroxy-3-(3-imidazol-1-ylpropyl)-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenamide (PubChem CID 169177722) has the molecular formula C32H46FN3O2 and a molecular weight of 523.74 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-(4-fluorocyclohexyl)-9-[3-hydroxy-3-(3-imidazol-1-ylpropyl)-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N-(4-fluorocyclohexyl)-9-[3-hydroxy-3-(3-imidazol-1-ylpropyl)-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 169177722 |
| Molecular Formula | C32H46FN3O2 |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.36 |
| IUPAC Name | (2E,4E,6E,8E)-N-(4-fluorocyclohexyl)-9-[3-hydroxy-3-(3-imidazol-1-ylpropyl)-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NC2CCC(F)CC2)C(C)(C)CCC1(O)CCCn1ccnc1 |
| InChI | InChI=1S/C32H46FN3O2/c1-24(8-6-9-25(2)22-30(37)35-28-13-11-27(33)12-14-28)10-15-29-26(3)32(38,18-17-31(29,4)5)16-7-20-36-21-19-34-23-36/h6,8-10,15,19,21-23,27-28,38H,7,11-14,16-18,20H2,1-5H3,(H,35,37)/b9-6+,15-10+,24-8+,25-22+ |
| InChIKey | VFWUZHNWXICKBB-RGIIKEMGSA-N |
| XLogP | 6.93 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|