C25H39N3O4S — CID 143964042
[4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(4,4,6-trimethyl-2,3-dihydro-1H-pyridin-5-yl)nona-2,4,6,8-tetraenoyl]amino]cyclohexyl] sulfamate (PubChem CID 143964042) has the molecular formula C25H39N3O4S and a molecular weight of 477.67 g/mol. Its IUPAC name is [4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(4,4,6-trimethyl-2,3-dihydro-1H-pyridin-5-yl)nona-2,4,6,8-tetraenoyl]amino]cyclohexyl] sulfamate.
| Compound Name | [4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(4,4,6-trimethyl-2,3-dihydro-1H-pyridin-5-yl)nona-2,4,6,8-tetraenoyl]amino]cyclohexyl] sulfamate |
|---|---|
| PubChem CID | 143964042 |
| Molecular Formula | C25H39N3O4S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | [4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(4,4,6-trimethyl-2,3-dihydro-1H-pyridin-5-yl)nona-2,4,6,8-tetraenoyl]amino]cyclohexyl] sulfamate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NC2CCC(OS(N)(=O)=O)CC2)C(C)(C)CCN1 |
| InChI | InChI=1S/C25H39N3O4S/c1-18(9-14-23-20(3)27-16-15-25(23,4)5)7-6-8-19(2)17-24(29)28-21-10-12-22(13-11-21)32-33(26,30)31/h6-9,14,17,21-22,27H,10-13,15-16H2,1-5H3,(H,28,29)(H2,26,30,31)/b8-6+,14-9+,18-7+,19-17+ |
| InChIKey | WXTVBEFXYYAMPA-KFJFTADJSA-N |
| XLogP | 3.93 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|