C26H35BFNO5 — CID 169177734
CID 169177734 (PubChem CID 169177734) has the molecular formula C26H35BFNO5 and a molecular weight of 471.38 g/mol.
| Compound Name | CID 169177734 |
|---|---|
| PubChem CID | 169177734 |
| Molecular Formula | C26H35BFNO5 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | — |
| SMILES | [B]C1C(O)C(F)C(O)C(O)C1NC(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C(=O)CCC1(C)C |
| InChI | InChI=1S/C26H35BFNO5/c1-14(9-10-17-16(3)18(30)11-12-26(17,4)5)7-6-8-15(2)13-19(31)29-22-20(27)23(32)21(28)24(33)25(22)34/h6-10,13,20-25,32-34H,11-12H2,1-5H3,(H,29,31)/b8-6+,10-9+,14-7+,15-13+ |
| InChIKey | AHNGQGFCSZZBAV-FRCNGJHJSA-N |
| XLogP | 2.57 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|