C24H34O3 — CID 73310521
tert-butyl 3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 73310521) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is tert-butyl 3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | tert-butyl 3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 73310521 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | tert-butyl 3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CC(C=CC1=C(C)C(=O)CCC1(C)C)=CC=CC(C)=CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H34O3/c1-17(10-9-11-18(2)16-22(26)27-23(4,5)6)12-13-20-19(3)21(25)14-15-24(20,7)8/h9-13,16H,14-15H2,1-8H3 |
| InChIKey | HEGYYKXTINCKMG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|