C22H28O3 — CID 175101927
methyl (2E)-3,7-dimethyl-9-[2,6,6-trimethyl-3-(oxomethylidene)cyclohexen-1-yl]nona-2,4,6,8-tetraenoate (PubChem CID 175101927) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is methyl (2E)-3,7-dimethyl-9-[2,6,6-trimethyl-3-(oxomethylidene)cyclohexen-1-yl]nona-2,4,6,8-tetraenoate.
| Compound Name | methyl (2E)-3,7-dimethyl-9-[2,6,6-trimethyl-3-(oxomethylidene)cyclohexen-1-yl]nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 175101927 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | methyl (2E)-3,7-dimethyl-9-[2,6,6-trimethyl-3-(oxomethylidene)cyclohexen-1-yl]nona-2,4,6,8-tetraenoate |
| SMILES | COC(=O)/C=C(\C)C=CC=C(C)C=CC1=C(C)C(=C=O)CCC1(C)C |
| InChI | InChI=1S/C22H28O3/c1-16(8-7-9-17(2)14-21(24)25-6)10-11-20-18(3)19(15-23)12-13-22(20,4)5/h7-11,14H,12-13H2,1-6H3/b9-7?,11-10?,16-8?,17-14+ |
| InChIKey | HDGGPHMENKCBIK-TWIZRCNBSA-N |
| XLogP | 5.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|