C22H28O3 — CID 100976828
(2E,4E,6E,8E,10E)-5,9-dimethyl-11-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)undeca-2,4,6,8,10-pentaenoic acid (PubChem CID 100976828) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E)-5,9-dimethyl-11-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)undeca-2,4,6,8,10-pentaenoic acid.
| Compound Name | (2E,4E,6E,8E,10E)-5,9-dimethyl-11-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)undeca-2,4,6,8,10-pentaenoic acid |
|---|---|
| PubChem CID | 100976828 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (2E,4E,6E,8E,10E)-5,9-dimethyl-11-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)undeca-2,4,6,8,10-pentaenoic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C(=O)O)C(C)(C)CCC1=O |
| InChI | InChI=1S/C22H28O3/c1-16(10-7-11-21(24)25)8-6-9-17(2)12-13-19-18(3)20(23)14-15-22(19,4)5/h6-13H,14-15H2,1-5H3,(H,24,25)/b8-6+,11-7+,13-12+,16-10+,17-9+ |
| InChIKey | OEXTVYNXCNNBNB-GMSQKIGWSA-N |
| XLogP | 5.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|