C33H44O3 — CID 177419906
3-[(1E,3E,5E,7E,9E,11E,13E,15E)-16-(1,3-dioxan-2-yl)-3,7,12-trimethylheptadeca-1,3,5,7,9,11,13,15-octaenyl]-2,4,4-trimethylcyclohex-2-en-1-one (PubChem CID 177419906) has the molecular formula C33H44O3 and a molecular weight of 488.71 g/mol. Its IUPAC name is 3-[(1E,3E,5E,7E,9E,11E,13E,15E)-16-(1,3-dioxan-2-yl)-3,7,12-trimethylheptadeca-1,3,5,7,9,11,13,15-octaenyl]-2,4,4-trimethylcyclohex-2-en-1-one.
| Compound Name | 3-[(1E,3E,5E,7E,9E,11E,13E,15E)-16-(1,3-dioxan-2-yl)-3,7,12-trimethylheptadeca-1,3,5,7,9,11,13,15-octaenyl]-2,4,4-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 177419906 |
| Molecular Formula | C33H44O3 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | 3-[(1E,3E,5E,7E,9E,11E,13E,15E)-16-(1,3-dioxan-2-yl)-3,7,12-trimethylheptadeca-1,3,5,7,9,11,13,15-octaenyl]-2,4,4-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(\C)C2OCCCO2)C(C)(C)CCC1=O |
| InChI | InChI=1S/C33H44O3/c1-25(13-8-9-14-26(2)17-11-18-28(4)32-35-23-12-24-36-32)15-10-16-27(3)19-20-30-29(5)31(34)21-22-33(30,6)7/h8-11,13-20,32H,12,21-24H2,1-7H3/b9-8+,15-10+,17-11+,20-19+,25-13+,26-14+,27-16+,28-18+ |
| InChIKey | VFRFOYFJIKRIGT-PPYNZDQLSA-N |
| XLogP | 8.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|