C23H34O — CID 143285180
2,4,4-trimethyl-3-[(1E,3E,5E,7E)-3,7,9,9-tetramethyldeca-1,3,5,7-tetraenyl]cyclohex-2-en-1-one (PubChem CID 143285180) has the molecular formula C23H34O and a molecular weight of 326.52 g/mol. Its IUPAC name is 2,4,4-trimethyl-3-[(1E,3E,5E,7E)-3,7,9,9-tetramethyldeca-1,3,5,7-tetraenyl]cyclohex-2-en-1-one.
| Compound Name | 2,4,4-trimethyl-3-[(1E,3E,5E,7E)-3,7,9,9-tetramethyldeca-1,3,5,7-tetraenyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 143285180 |
| Molecular Formula | C23H34O |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | 2,4,4-trimethyl-3-[(1E,3E,5E,7E)-3,7,9,9-tetramethyldeca-1,3,5,7-tetraenyl]cyclohex-2-en-1-one |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(C)(C)C)C(C)(C)CCC1=O |
| InChI | InChI=1S/C23H34O/c1-17(10-9-11-18(2)16-22(4,5)6)12-13-20-19(3)21(24)14-15-23(20,7)8/h9-13,16H,14-15H2,1-8H3/b11-9+,13-12+,17-10+,18-16+ |
| InChIKey | MWUYZRLZZQZJJR-GJGPKCTFSA-N |
| XLogP | 6.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|