C31H44B2FN3O7 — CID 169177735
CID 169177735 (PubChem CID 169177735) has the molecular formula C31H44B2FN3O7 and a molecular weight of 611.33 g/mol.
| Compound Name | CID 169177735 |
|---|---|
| PubChem CID | 169177735 |
| Molecular Formula | C31H44B2FN3O7 |
| Molecular Weight | 611.33 g/mol |
| Exact Mass | 611.33 |
| IUPAC Name | — |
| SMILES | [B]C1C(O)C(NC(=O)/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)C(C)(O)CCC2(C)C)C(O)C(O)C1F.[B]c1nc(O)c(O)n1C |
| InChI | InChI=1S/C27H39BFNO5.C4H5BN2O2/c1-15(10-11-18-17(3)27(6,35)13-12-26(18,4)5)8-7-9-16(2)14-19(31)30-22-23(32)20(28)21(29)24(33)25(22)34;1-7-3(9)2(8)6-4(7)5/h7-11,14,20-25,32-35H,12-13H2,1-6H3,(H,30,31);8-9H,1H3/b9-7+,11-10+,15-8+,16-14+; |
| InChIKey | NQADXFIXHXIIPC-SPCNRHPPSA-N |
| XLogP | 1.38 |
| TPSA | 168.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|