C29H38B2FN3O7 — CID 169177749
CID 169177749 (PubChem CID 169177749) has the molecular formula C29H38B2FN3O7 and a molecular weight of 581.26 g/mol.
| Compound Name | CID 169177749 |
|---|---|
| PubChem CID | 169177749 |
| Molecular Formula | C29H38B2FN3O7 |
| Molecular Weight | 581.26 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | — |
| SMILES | [B]c1nc(O)c([B])n1C1(O)CCC(C)(C)C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NC2C(O)C(O)C(F)C(O)C2O)=C1C |
| InChI | InChI=1S/C29H38B2FN3O7/c1-14(7-6-8-15(2)13-18(36)33-20-23(39)21(37)19(32)22(38)24(20)40)9-10-17-16(3)29(42,12-11-28(17,4)5)35-25(30)26(41)34-27(35)31/h6-10,13,19-24,37-42H,11-12H2,1-5H3,(H,33,36)/b8-6+,10-9+,14-7+,15-13+ |
| InChIKey | FJPVQRUPNKSJNU-FRCNGJHJSA-N |
| XLogP | -0.76 |
| TPSA | 168.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.26 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|