C16H17N5O — CID 95760446
1-(3-cyanophenyl)-3-[(1R,2R)-2-imidazol-1-ylcyclopentyl]urea (PubChem CID 95760446) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[(1R,2R)-2-imidazol-1-ylcyclopentyl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[(1R,2R)-2-imidazol-1-ylcyclopentyl]urea |
|---|---|
| PubChem CID | 95760446 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[(1R,2R)-2-imidazol-1-ylcyclopentyl]urea |
| SMILES | N#Cc1cccc(NC(=O)N[C@@H]2CCC[C@H]2n2ccnc2)c1 |
| InChI | InChI=1S/C16H17N5O/c17-10-12-3-1-4-13(9-12)19-16(22)20-14-5-2-6-15(14)21-8-7-18-11-21/h1,3-4,7-9,11,14-15H,2,5-6H2,(H2,19,20,22)/t14-,15-/m1/s1 |
| InChIKey | ZJEJQLCWTGNVRM-HUUCEWRRSA-N |
| XLogP | 2.67 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |