C14H17N3O2 — CID 94414975
1-(3-cyanophenyl)-3-[(1R,2R)-2-hydroxycyclohexyl]urea (PubChem CID 94414975) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[(1R,2R)-2-hydroxycyclohexyl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[(1R,2R)-2-hydroxycyclohexyl]urea |
|---|---|
| PubChem CID | 94414975 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[(1R,2R)-2-hydroxycyclohexyl]urea |
| SMILES | N#Cc1cccc(NC(=O)N[C@@H]2CCCC[C@H]2O)c1 |
| InChI | InChI=1S/C14H17N3O2/c15-9-10-4-3-5-11(8-10)16-14(19)17-12-6-1-2-7-13(12)18/h3-5,8,12-13,18H,1-2,6-7H2,(H2,16,17,19)/t12-,13-/m1/s1 |
| InChIKey | ZCJLDWSXRXOGCQ-CHWSQXEVSA-N |
| XLogP | 1.98 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |