C18H26N2O3 — CID 110933001
1-(3-cyclopentyloxyphenyl)-3-(2-hydroxycyclohexyl)urea (PubChem CID 110933001) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(3-cyclopentyloxyphenyl)-3-(2-hydroxycyclohexyl)urea.
| Compound Name | 1-(3-cyclopentyloxyphenyl)-3-(2-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 110933001 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-(3-cyclopentyloxyphenyl)-3-(2-hydroxycyclohexyl)urea |
| SMILES | O=C(Nc1cccc(OC2CCCC2)c1)NC1CCCCC1O |
| InChI | InChI=1S/C18H26N2O3/c21-17-11-4-3-10-16(17)20-18(22)19-13-6-5-9-15(12-13)23-14-7-1-2-8-14/h5-6,9,12,14,16-17,21H,1-4,7-8,10-11H2,(H2,19,20,22) |
| InChIKey | PJNCOPYZMANCFL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |