C16H20N4O2 — CID 47075796
2-[(3-cyanophenyl)carbamoylamino]-N-cyclopentylpropanamide (PubChem CID 47075796) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[(3-cyanophenyl)carbamoylamino]-N-cyclopentylpropanamide.
| Compound Name | 2-[(3-cyanophenyl)carbamoylamino]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 47075796 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-[(3-cyanophenyl)carbamoylamino]-N-cyclopentylpropanamide |
| SMILES | CC(NC(=O)Nc1cccc(C#N)c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H20N4O2/c1-11(15(21)19-13-6-2-3-7-13)18-16(22)20-14-8-4-5-12(9-14)10-17/h4-5,8-9,11,13H,2-3,6-7H2,1H3,(H,19,21)(H2,18,20,22) |
| InChIKey | NLSCJCXNKMIMGJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |