C12H13N3O2 — CID 64993876
1-(3-cyanophenyl)-3-(3-oxobutan-2-yl)urea (PubChem CID 64993876) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-(3-oxobutan-2-yl)urea.
| Compound Name | 1-(3-cyanophenyl)-3-(3-oxobutan-2-yl)urea |
|---|---|
| PubChem CID | 64993876 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-(3-cyanophenyl)-3-(3-oxobutan-2-yl)urea |
| SMILES | CC(=O)C(C)NC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C12H13N3O2/c1-8(9(2)16)14-12(17)15-11-5-3-4-10(6-11)7-13/h3-6,8H,1-2H3,(H2,14,15,17) |
| InChIKey | IVMSHFHKATZOOR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |