C11H13N3O2 — CID 79023685
1-(3-cyanophenyl)-3-[(2S)-1-hydroxypropan-2-yl]urea (PubChem CID 79023685) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[(2S)-1-hydroxypropan-2-yl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[(2S)-1-hydroxypropan-2-yl]urea |
|---|---|
| PubChem CID | 79023685 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[(2S)-1-hydroxypropan-2-yl]urea |
| SMILES | C[C@@H](CO)NC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C11H13N3O2/c1-8(7-15)13-11(16)14-10-4-2-3-9(5-10)6-12/h2-5,8,15H,7H2,1H3,(H2,13,14,16)/t8-/m0/s1 |
| InChIKey | HODXNPUASJKYPK-QMMMGPOBSA-N |
| XLogP | 1.06 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |