C14H15N3O — CID 115662974
1-(3-cyanophenyl)-3-hex-5-yn-3-ylurea (PubChem CID 115662974) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-hex-5-yn-3-ylurea.
| Compound Name | 1-(3-cyanophenyl)-3-hex-5-yn-3-ylurea |
|---|---|
| PubChem CID | 115662974 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 1-(3-cyanophenyl)-3-hex-5-yn-3-ylurea |
| SMILES | C#CCC(CC)NC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C14H15N3O/c1-3-6-12(4-2)16-14(18)17-13-8-5-7-11(9-13)10-15/h1,5,7-9,12H,4,6H2,2H3,(H2,16,17,18) |
| InChIKey | VOMSTYKWAKTCAD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|